| MolName | 2-(furan-2-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]quinoline-4-carboxamide |
| MolecularFormula | C21H14N4O4 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(c2cc(-c3ccco3)nc3ccccc23)=O)cc1)=O |
| InChI | InChI=1S/C21H14N4O4/c26-21(24-22-13-14-7-9-15(10-8-14)25(27)28)17-12-19(20-6-3-11-29-20)23-18-5-2-1-4-16(17)18/h1-13H,(H,24,26) |
| InChIK | UFXKYSGTVCXFOJ-UHFFFAOYSA-N |
| TotalMolweight | 386.366 |
| Molweight | 386.366 |
| MonoisotopicMass | 386.101506 |
| CLogP | 3.5719 |
| CLogS | -6.015 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 293.47 |
| Relative PSA | 0.31182 |
| PolarSurfaceArea | 113.31 |
| Druglikeness | -0.90667 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(furan-2-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]quinoline-4-carboxamide | 2 - 2-(furan-2-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]quinoline-4-carboxamide