| MolName | 2-[2-[(Z)-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioylhydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C17H13N3O3ClF3S |
| Smiles | OC(COc1c(/C=N\NC(Nc(cc(C(F)(F)F)cc2)c2Cl)=S)cccc1)=O |
| InChI | InChI=1S/C17H13ClF3N3O3S/c18-12-6-5-11(17(19,20)21)7-13(12)23-16(28)24-22-8-10-3-1-2-4-14(10)27-9-15(25)26/h1-8H,9H2,(H,25,26)(H2,23,24,28) |
| InChIK | UGBAMGFDHMZJAA-UHFFFAOYSA-N |
| TotalMolweight | 431.821 |
| Molweight | 431.821 |
| MonoisotopicMass | 431.031823 |
| CLogP | 4.1065 |
| CLogS | -5.628 |
| H Acceptors | 6 |
| H Donors | 3 |
| TotalSurfaceArea | 306.15 |
| Relative PSA | 0.32197 |
| PolarSurfaceArea | 115.04 |
| Druglikeness | -4.8177 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioylhydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[2-[(Z)-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioylhydrazinylidene]methyl]phenoxy]acetic acid