| MolName | (2S,3S,4R,5S)-2-[6-amino-8-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| MolecularFormula | C15H16N8O7 |
| Smiles | Nc1ncnc2c1nc(N/N=C\c1ccc([N+]([O-])=O)o1)n2[C@H]([C@H]1O)O[C@@H](CO)[C@@H]1O |
| InChI | InChI=1S/C15H16N8O7/c16-12-9-13(18-5-17-12)22(14-11(26)10(25)7(4-24)30-14)15(20-9)21-19-3-6-1-2-8(29-6)23(27)28/h1-3,5,7,10-11,14,24-26H,4H2,(H,20,21)(H2,16,17,18)/t7-,10-,11+,14+/m1/s1 |
| InChIK | UGCCNZSJRBTPTF-RPZVGCSNSA-N |
| TotalMolweight | 420.341 |
| Molweight | 420.341 |
| MonoisotopicMass | 420.114197 |
| CLogP | 0.2593 |
| CLogS | -4.796 |
| H Acceptors | 15 |
| H Donors | 5 |
| TotalSurfaceArea | 290.51 |
| Relative PSA | 0.59155 |
| PolarSurfaceArea | 222.89 |
| Druglikeness | -0.1794 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 15 |
| Electronegative Atoms | 15 |
| StereoCenters | 4 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 14 |
| Sp3Atoms | 10 |
| Aromatic Nitrogens | 4 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (2S,3S,4R,5S)-2-[6-amino-8-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol | 2 - (2S,3S,4R,5S)-2-[6-amino-8-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol