| MolName | N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]-3-pyrrolidin-1-ylsulfonylbenzamide |
| MolecularFormula | C19H19N3O4F2S |
| Smiles | O=C(c1cccc(S(N2CCCC2)(=O)=O)c1)N/N=C\c(cc1)ccc1OC(F)F |
| InChI | InChI=1S/C19H19F2N3O4S/c20-19(21)28-16-8-6-14(7-9-16)13-22-23-18(25)15-4-3-5-17(12-15)29(26,27)24-10-1-2-11-24/h3-9,12-13,19H,1-2,10-11H2,(H,23,25) |
| InChIK | UGTXMMRGLSAGOE-UHFFFAOYSA-N |
| TotalMolweight | 423.439 |
| Molweight | 423.439 |
| MonoisotopicMass | 423.106433 |
| CLogP | 3.2358 |
| CLogS | -4.168 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 302.61 |
| Relative PSA | 0.25822 |
| PolarSurfaceArea | 96.45 |
| Druglikeness | -1.6101 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62069 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]-3-pyrrolidin-1-ylsulfonylbenzamide | 2 - N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]-3-pyrrolidin-1-ylsulfonylbenzamide