| MolName | (Z)-1-[5-(azepan-1-yl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C13H17N5O |
| Smiles | C(CCC1)CCN1c1ccc(/C=N\n2cnnc2)o1 |
| InChI | InChI=1S/C13H17N5O/c1-2-4-8-17(7-3-1)13-6-5-12(19-13)9-16-18-10-14-15-11-18/h5-6,9-11H,1-4,7-8H2 |
| InChIK | UGYHFDMGIMXKKV-UHFFFAOYSA-N |
| TotalMolweight | 259.312 |
| Molweight | 259.312 |
| MonoisotopicMass | 259.14331 |
| CLogP | 1.9434 |
| CLogS | -5.779 |
| H Acceptors | 6 |
| TotalSurfaceArea | 213.55 |
| Relative PSA | 0.27151 |
| PolarSurfaceArea | 59.45 |
| Druglikeness | 3.1501 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.63158 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 6 |
| Symmetricatoms | 5 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[5-(azepan-1-yl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[5-(azepan-1-yl)furan-2-yl]-N-(1,2,4-triazol-4-yl)methanimine