| MolName | [(Z)-[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]thiourea |
| MolecularFormula | C12H9N3OBrClS2 |
| Smiles | NC(N/N=C\c(o1)cc(Br)c1Sc(cc1)ccc1Cl)=S |
| InChI | InChI=1S/C12H9BrClN3OS2/c13-10-5-8(6-16-17-12(15)19)18-11(10)20-9-3-1-7(14)2-4-9/h1-6H,(H3,15,17,19) |
| InChIK | UGYUCNPOOURXPS-UHFFFAOYSA-N |
| TotalMolweight | 390.712 |
| Molweight | 390.712 |
| MonoisotopicMass | 388.90589 |
| CLogP | 3.9704 |
| CLogS | -5.699 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 251.7 |
| Relative PSA | 0.38872 |
| PolarSurfaceArea | 120.94 |
| Druglikeness | -2.5615 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]thiourea | 2 - [(Z)-[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]thiourea