| MolName | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]thiourea |
| MolecularFormula | C16H16N4O5S2 |
| Smiles | [O-][N+](c(cccc1)c1-c1ccc(/C=N\NC(N[C@H](CC2)CS2(=O)=O)=S)o1)=O |
| InChI | InChI=1S/C16H16N4O5S2/c21-20(22)14-4-2-1-3-13(14)15-6-5-12(25-15)9-17-19-16(26)18-11-7-8-27(23,24)10-11/h1-6,9,11H,7-8,10H2,(H2,18,19,26)/t11-/m0/s1 |
| InChIK | UGZHKPIKIOGNAE-NSHDSACASA-N |
| TotalMolweight | 408.458 |
| Molweight | 408.458 |
| MonoisotopicMass | 408.056211 |
| CLogP | 1.2645 |
| CLogS | -5.278 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 295.63 |
| Relative PSA | 0.45848 |
| PolarSurfaceArea | 169.99 |
| Druglikeness | -4.9585 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.59259 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| StereoCenters | 1 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 7 |
| Symmetricatoms | 1 |
| AcidicOxygens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]thiourea | 2 - 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]thiourea