| MolName | N-[(Z)-(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]-1H-indole-3-carboxamide |
| MolecularFormula | C22H21N5OS2 |
| Smiles | O=C(c1c[nH]c2c1cccc2)N/N=C\c1c(-c2cccs2)nc(N2CCCCC2)s1 |
| InChI | InChI=1S/C22H21N5OS2/c28-21(16-13-23-17-8-3-2-7-15(16)17)26-24-14-19-20(18-9-6-12-29-18)25-22(30-19)27-10-4-1-5-11-27/h2-3,6-9,12-14,23H,1,4-5,10-11H2,(H,26,28) |
| InChIK | UHHASWDVMSRCAL-UHFFFAOYSA-N |
| TotalMolweight | 435.575 |
| Molweight | 435.575 |
| MonoisotopicMass | 435.11875 |
| CLogP | 5.5552 |
| CLogS | -6.78 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 327.16 |
| Relative PSA | 0.32168 |
| PolarSurfaceArea | 129.86 |
| Druglikeness | 6.741 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]-1H-indole-3-carboxamide | 2 - N-[(Z)-(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]-1H-indole-3-carboxamide