| MolName | N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]quinolin-2-amine |
| MolecularFormula | C30H22N4 |
| Smiles | C(c(c1c2cccc1)c(-c1ccccc1)n2-c1ccccc1)=N\Nc1nc2ccccc2cc1 |
| InChI | InChI=1S/C30H22N4/c1-3-12-23(13-4-1)30-26(21-31-33-29-20-19-22-11-7-9-17-27(22)32-29)25-16-8-10-18-28(25)34(30)24-14-5-2-6-15-24/h1-21H,(H,32,33) |
| InChIK | UHMJRXYKNMEHEG-UHFFFAOYSA-N |
| TotalMolweight | 438.533 |
| Molweight | 438.533 |
| MonoisotopicMass | 438.184446 |
| CLogP | 8.7603 |
| CLogS | -9.972 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 345.92 |
| Relative PSA | 0.11798 |
| PolarSurfaceArea | 42.21 |
| Druglikeness | 3.7867 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.47059 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 5 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 31 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]quinolin-2-amine | 2 - N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]quinolin-2-amine