| MolName | 2-fluoro-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]benzamide |
| MolecularFormula | C16H12N3O3F |
| Smiles | [O-][N+](c1c(/C=C/C=N\NC(c(cccc2)c2F)=O)cccc1)=O |
| InChI | InChI=1S/C16H12FN3O3/c17-14-9-3-2-8-13(14)16(21)19-18-11-5-7-12-6-1-4-10-15(12)20(22)23/h1-11H,(H,19,21) |
| InChIK | UHQITMXLBIIXJJ-UHFFFAOYSA-N |
| TotalMolweight | 313.287 |
| Molweight | 313.287 |
| MonoisotopicMass | 313.08627 |
| CLogP | 2.3991 |
| CLogS | -4.787 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 243.51 |
| Relative PSA | 0.2728 |
| PolarSurfaceArea | 87.28 |
| Druglikeness | -2.0595 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6087 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-fluoro-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]benzamide | 2 - 2-fluoro-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]benzamide