| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-fluorophenoxy)methyl]-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]triazole-4-carboxamide |
| MolecularFormula | C20H14N8O3F4 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2ccc(C(F)(F)F)cc2)=O)c1COc(cc1)ccc1F |
| InChI | InChI=1S/C20H14F4N8O3/c21-13-5-7-14(8-6-13)34-10-15-16(27-31-32(15)18-17(25)29-35-30-18)19(33)28-26-9-11-1-3-12(4-2-11)20(22,23)24/h1-9H,10H2,(H2,25,29)(H,28,33) |
| InChIK | UHRWPQYIOBPEIS-UHFFFAOYSA-N |
| TotalMolweight | 490.376 |
| Molweight | 490.376 |
| MonoisotopicMass | 490.112499 |
| CLogP | 4.0466 |
| CLogS | -3.885 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 348.53 |
| Relative PSA | 0.36192 |
| PolarSurfaceArea | 146.34 |
| Druglikeness | -5.4692 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54286 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 15 |
| Electronegative Atoms | 15 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-fluorophenoxy)methyl]-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-fluorophenoxy)methyl]-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]triazole-4-carboxamide