| MolName | (Z)-1-(1,2-diphenylindol-3-yl)-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C23H17N5 |
| Smiles | C(c(c1c2cccc1)c(-c1ccccc1)n2-c1ccccc1)=N\n1cnnc1 |
| InChI | InChI=1S/C23H17N5/c1-3-9-18(10-4-1)23-21(15-26-27-16-24-25-17-27)20-13-7-8-14-22(20)28(23)19-11-5-2-6-12-19/h1-17H |
| InChIK | UIDONHIHZMWVHF-UHFFFAOYSA-N |
| TotalMolweight | 363.423 |
| Molweight | 363.423 |
| MonoisotopicMass | 363.148395 |
| CLogP | 4.4803 |
| CLogS | -9.902 |
| H Acceptors | 5 |
| TotalSurfaceArea | 287.82 |
| Relative PSA | 0.16396 |
| PolarSurfaceArea | 48 |
| Druglikeness | 4.7143 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.42857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(1,2-diphenylindol-3-yl)-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-(1,2-diphenylindol-3-yl)-N-(1,2,4-triazol-4-yl)methanimine