| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]-5-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)triazole-4-carboxamide |
| MolecularFormula | C22H21N10O4 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc2)ccc2[N+]([O-])=O)=O)c1C[NH+](CC1)Cc2c1cccc2 |
| InChI | InChI=1S/C22H20N10O4/c23-20-21(28-36-27-20)31-18(13-30-10-9-15-3-1-2-4-16(15)12-30)19(25-29-31)22(33)26-24-11-14-5-7-17(8-6-14)32(34)35/h1-8,11H,9-10,12-13H2,(H2,23,27)(H,26,33)/p+1 |
| InChIK | UIYPFWJSQWZIAI-UHFFFAOYSA-O |
| TotalMolweight | 489.475 |
| Molweight | 489.475 |
| MonoisotopicMass | 489.174725 |
| CLogP | 1.1697 |
| CLogS | -3.098 |
| H Acceptors | 14 |
| H Donors | 3 |
| TotalSurfaceArea | 378.51 |
| Relative PSA | 0.43367 |
| PolarSurfaceArea | 187.37 |
| Druglikeness | -3.1715 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52778 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| StereoCenters | 1 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 5 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon | racemate |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]-5-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-nitrophenyl)methylideneamino]-5-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-ylmethyl)triazole-4-carboxamide