| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-carbamoylanilino)methyl]-N-[(Z)-(2-nitrophenyl)methylideneamino]triazole-4-carboxamide |
| MolecularFormula | C20H17N11O5 |
| Smiles | NC(c(cccc1)c1NCc1c(C(N/N=C\c(cccc2)c2[N+]([O-])=O)=O)nnn1-c1nonc1N)=O |
| InChI | InChI=1S/C20H17N11O5/c21-17-19(28-36-27-17)30-15(10-23-13-7-3-2-6-12(13)18(22)32)16(25-29-30)20(33)26-24-9-11-5-1-4-8-14(11)31(34)35/h1-9,23H,10H2,(H2,21,27)(H2,22,32)(H,26,33) |
| InChIK | UJLQNPOUUAOHAG-UHFFFAOYSA-N |
| TotalMolweight | 491.427 |
| Molweight | 491.427 |
| MonoisotopicMass | 491.141414 |
| CLogP | 0.9802 |
| CLogS | -3.384 |
| H Acceptors | 16 |
| H Donors | 4 |
| TotalSurfaceArea | 364.12 |
| Relative PSA | 0.51173 |
| PolarSurfaceArea | 238.05 |
| Druglikeness | -2.3124 |
| Mutagenic | high |
| Tumorigenic | low |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.44444 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 16 |
| Electronegative Atoms | 16 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Amides | 1 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 5 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-carbamoylanilino)methyl]-N-[(Z)-(2-nitrophenyl)methylideneamino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(2-carbamoylanilino)methyl]-N-[(Z)-(2-nitrophenyl)methylideneamino]triazole-4-carboxamide