| MolName | [4-[(Z)-[(5,5-diphenyl-1,4-dihydropyrazole-3-carbonyl)hydrazinylidene]methyl]phenyl] 3-fluorobenzoate |
| MolecularFormula | C30H23N4O3F |
| Smiles | O=C(C(C1)=NNC1(c1ccccc1)c1ccccc1)N/N=C\c(cc1)ccc1OC(c1cccc(F)c1)=O |
| InChI | InChI=1S/C30H23FN4O3/c31-25-13-7-8-22(18-25)29(37)38-26-16-14-21(15-17-26)20-32-34-28(36)27-19-30(35-33-27,23-9-3-1-4-10-23)24-11-5-2-6-12-24/h1-18,20,35H,19H2,(H,34,36) |
| InChIK | UJVXBBXJPHQNEX-UHFFFAOYSA-N |
| TotalMolweight | 506.536 |
| Molweight | 506.536 |
| MonoisotopicMass | 506.175419 |
| CLogP | 5.5129 |
| CLogS | -7.085 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 385.71 |
| Relative PSA | 0.21265 |
| PolarSurfaceArea | 92.15 |
| Druglikeness | 4.3669 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55263 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 3 |
| Symmetricatoms | 10 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[(5,5-diphenyl-1,4-dihydropyrazole-3-carbonyl)hydrazinylidene]methyl]phenyl] 3-fluorobenzoate | 2 - [4-[(Z)-[(5,5-diphenyl-1,4-dihydropyrazole-3-carbonyl)hydrazinylidene]methyl]phenyl] 3-fluorobenzoate