| MolName | N-[(Z)-[5-(2-bromophenyl)furan-2-yl]methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide |
| MolecularFormula | C22H16N3O4BrS2 |
| Smiles | O=C(c(cc1)ccc1NS(c1cccs1)(=O)=O)N/N=C\c1ccc(-c(cccc2)c2Br)o1 |
| InChI | InChI=1S/C22H16BrN3O4S2/c23-19-5-2-1-4-18(19)20-12-11-17(30-20)14-24-25-22(27)15-7-9-16(10-8-15)26-32(28,29)21-6-3-13-31-21/h1-14,26H,(H,25,27) |
| InChIK | UJWSTRYHZOKMIV-UHFFFAOYSA-N |
| TotalMolweight | 530.422 |
| Molweight | 530.422 |
| MonoisotopicMass | 528.976558 |
| CLogP | 5.1539 |
| CLogS | -7.265 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 350.81 |
| Relative PSA | 0.31504 |
| PolarSurfaceArea | 137.39 |
| Druglikeness | 4.6314 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 1 |
| Symmetricatoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(2-bromophenyl)furan-2-yl]methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide | 2 - N-[(Z)-[5-(2-bromophenyl)furan-2-yl]methylideneamino]-4-(thiophen-2-ylsulfonylamino)benzamide