| MolName | 2-N-[(Z)-[4-[(Z)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl]methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C38H32N14 |
| Smiles | C(c1ccc(/C=N\Nc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)cc1)=N\Nc1nc(Nc2ccccc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C38H32N14/c1-5-13-29(14-6-1)41-33-45-34(42-30-15-7-2-8-16-30)48-37(47-33)51-39-25-27-21-23-28(24-22-27)26-40-52-38-49-35(43-31-17-9-3-10-18-31)46-36(50-38)44-32-19-11-4-12-20-32/h1-26H,(H3,41,42,45,47,48,51)(H3,43,44,46,49,50,52) |
| InChIK | UJWYDRIXLPZUAO-UHFFFAOYSA-N |
| TotalMolweight | 684.77 |
| Molweight | 684.77 |
| MonoisotopicMass | 684.293436 |
| CLogP | 12.987 |
| CLogS | -11.366 |
| H Acceptors | 14 |
| H Donors | 6 |
| TotalSurfaceArea | 542.66 |
| Relative PSA | 0.29042 |
| PolarSurfaceArea | 174.24 |
| Druglikeness | 2.5594 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 52 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 14 |
| Rings Closures | 7 |
| Small Rings | 7 |
| Aromatic Rings | 7 |
| Aromatic Atoms | 42 |
| Symmetricatoms | 38 |
| Aromatic Nitrogens | 6 |
| BasicNitrogens | 6 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-[4-[(Z)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl]methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine | 2 - 2-N-[(Z)-[4-[(Z)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl]methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine