| MolName | 2-[2-[(Z)-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| MolecularFormula | C15H12N4O4F3 |
| Smiles | [O-]C(COc1c(/C=N\NC(Cn2nc(C(F)(F)F)cc2)=O)cccc1)=O |
| InChI | InChI=1S/C15H13F3N4O4/c16-15(17,18)12-5-6-22(21-12)8-13(23)20-19-7-10-3-1-2-4-11(10)26-9-14(24)25/h1-7H,8-9H2,(H,20,23)(H,24,25)/p-1 |
| InChIK | UJXHJVNCEPYFTA-UHFFFAOYSA-M |
| TotalMolweight | 369.278 |
| Molweight | 369.278 |
| MonoisotopicMass | 369.081065 |
| CLogP | -1.3552 |
| CLogS | -2.55 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 267.21 |
| Relative PSA | 0.34119 |
| PolarSurfaceArea | 108.64 |
| Druglikeness | -5.522 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]hydrazinylidene]methyl]phenoxy]acetate | 2 - 2-[2-[(Z)-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]hydrazinylidene]methyl]phenoxy]acetate