| MolName | 2-[4-[(Z)-[[2-(4-nitrophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C17H15N3O6 |
| Smiles | [O-][N+](c1ccc(CC(N/N=C\c(cc2)ccc2OCC(O)=O)=O)cc1)=O |
| InChI | InChI=1S/C17H15N3O6/c21-16(9-12-1-5-14(6-2-12)20(24)25)19-18-10-13-3-7-15(8-4-13)26-11-17(22)23/h1-8,10H,9,11H2,(H,19,21)(H,22,23) |
| InChIK | UKKRRPCOSFZSRX-UHFFFAOYSA-N |
| TotalMolweight | 357.321 |
| Molweight | 357.321 |
| MonoisotopicMass | 357.096087 |
| CLogP | 1.3381 |
| CLogS | -3.939 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 272.28 |
| Relative PSA | 0.37671 |
| PolarSurfaceArea | 133.81 |
| Druglikeness | -0.79231 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73077 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-[(Z)-[[2-(4-nitrophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[4-[(Z)-[[2-(4-nitrophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid