| MolName | [2-[(Z)-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]-4-nitrophenyl] benzoate |
| MolecularFormula | C28H20N4O6S |
| Smiles | [O-][N+](c(cc1)cc(/C=N\NC(/C(/NC(c2ccccc2)=O)=C\c2cccs2)=O)c1OC(c1ccccc1)=O)=O |
| InChI | InChI=1S/C28H20N4O6S/c33-26(19-8-3-1-4-9-19)30-24(17-23-12-7-15-39-23)27(34)31-29-18-21-16-22(32(36)37)13-14-25(21)38-28(35)20-10-5-2-6-11-20/h1-18H,(H,30,33)(H,31,34) |
| InChIK | ULXSAYRYPYRBCM-UHFFFAOYSA-N |
| TotalMolweight | 540.555 |
| Molweight | 540.555 |
| MonoisotopicMass | 540.110356 |
| CLogP | 5.1938 |
| CLogS | -7.406 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 407.79 |
| Relative PSA | 0.32941 |
| PolarSurfaceArea | 170.92 |
| Druglikeness | 2.3784 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48718 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 10 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]-4-nitrophenyl] benzoate | 2 - [2-[(Z)-[[(E)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]hydrazinylidene]methyl]-4-nitrophenyl] benzoate