| MolName | 2-(4-bromoanilino)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]acetamide |
| MolecularFormula | C15H12N3OBrCl2 |
| Smiles | O=C(CNc(cc1)ccc1Br)N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C15H12BrCl2N3O/c16-11-2-5-13(6-3-11)19-9-15(22)21-20-8-10-1-4-12(17)7-14(10)18/h1-8,19H,9H2,(H,21,22) |
| InChIK | UMFAEUZQQPJPNA-UHFFFAOYSA-N |
| TotalMolweight | 401.09 |
| Molweight | 401.09 |
| MonoisotopicMass | 398.954077 |
| CLogP | 4.4307 |
| CLogS | -5.849 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 261.68 |
| Relative PSA | 0.1814 |
| PolarSurfaceArea | 53.49 |
| Druglikeness | 3.2557 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72727 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-bromoanilino)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]acetamide | 2 - 2-(4-bromoanilino)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]acetamide