| MolName | 4-N,5-N-bis[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-1H-imidazole-4,5-dicarboxamide |
| MolecularFormula | C27H30N8O2Cl4 |
| Smiles | O=C(c1c(C(N/N=C\c(cc2)ccc2N(CCCl)CCCl)=O)nc[nH]1)N/N=C\c(cc1)ccc1N(CCCl)CCCl |
| InChI | InChI=1S/C27H30Cl4N8O2/c28-9-13-38(14-10-29)22-5-1-20(2-6-22)17-34-36-26(40)24-25(33-19-32-24)27(41)37-35-18-21-3-7-23(8-4-21)39(15-11-30)16-12-31/h1-8,17-19H,9-16H2,(H,32,33)(H,36,40)(H,37,41) |
| InChIK | UMIDWMYUHGFDSL-UHFFFAOYSA-N |
| TotalMolweight | 640.401 |
| Molweight | 640.401 |
| MonoisotopicMass | 638.12458 |
| CLogP | 5.347 |
| CLogS | -7.565 |
| H Acceptors | 10 |
| H Donors | 3 |
| TotalSurfaceArea | 481.41 |
| Relative PSA | 0.2162 |
| PolarSurfaceArea | 118.08 |
| Druglikeness | 8.5098 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63415 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 16 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 8 |
| Symmetricatoms | 10 |
| Amines | 2 |
| Aromatic Amines | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-N,5-N-bis[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-1H-imidazole-4,5-dicarboxamide | 2 - 4-N,5-N-bis[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-1H-imidazole-4,5-dicarboxamide