| MolName | 4-chloro-N-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]benzamide |
| MolecularFormula | C23H17N4OCl |
| Smiles | O=C(c(cc1)ccc1Cl)N/N=C\c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H17ClN4O/c24-20-13-11-18(12-14-20)23(29)26-25-15-19-16-28(21-9-5-2-6-10-21)27-22(19)17-7-3-1-4-8-17/h1-16H,(H,26,29) |
| InChIK | UMIZMKFPTMPDPH-UHFFFAOYSA-N |
| TotalMolweight | 400.868 |
| Molweight | 400.868 |
| MonoisotopicMass | 400.109088 |
| CLogP | 4.7266 |
| CLogS | -5.97 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 309.89 |
| Relative PSA | 0.17377 |
| PolarSurfaceArea | 59.28 |
| Druglikeness | 5.9239 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-N-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]benzamide | 2 - 4-chloro-N-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]benzamide