| MolName | 1-(4-chlorophenyl)-N-[(6Z,12Z)-2-[(4-chlorophenyl)methylideneamino]-6,12-diphenylbenzo[c][1,5]benzodiazocin-8-yl]methanimine |
| MolecularFormula | C40H26N4Cl2 |
| Smiles | Clc1ccc(/C=N/C2=C/C3=C(\c4ccccc4)/N=C(/C=CC(/N=C/c(cc4)ccc4Cl)=C4)\C4=C(\c4ccccc4)/N=C3/C=C2)cc1 |
| InChI | InChI=1S/C40H26Cl2N4/c41-31-15-11-27(12-16-31)25-43-33-19-21-37-35(23-33)39(29-7-3-1-4-8-29)45-38-22-20-34(44-26-28-13-17-32(42)18-14-28)24-36(38)40(46-37)30-9-5-2-6-10-30/h1-26H |
| InChIK | UMOOTOHTVAOFST-UHFFFAOYSA-N |
| TotalMolweight | 633.58 |
| Molweight | 633.58 |
| MonoisotopicMass | 632.15345 |
| CLogP | 8.9968 |
| CLogS | -9.806 |
| H Acceptors | 4 |
| TotalSurfaceArea | 486.6 |
| Relative PSA | 0.094616 |
| PolarSurfaceArea | 49.44 |
| Druglikeness | 1.5699 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 46 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 7 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Symmetricatoms | 27 |
| BasicNitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-chlorophenyl)-N-[(6Z,12Z)-2-[(4-chlorophenyl)methylideneamino]-6,12-diphenylbenzo[c][1,5]benzodiazocin-8-yl]methanimine | 2 - 1-(4-chlorophenyl)-N-[(6Z,12Z)-2-[(4-chlorophenyl)methylideneamino]-6,12-diphenylbenzo[c][1,5]benzodiazocin-8-yl]methanimine