| MolName | 1-chloro-2-[(Z)-(diphenylphosphinothioylhydrazinylidene)methyl]benzene |
| MolecularFormula | C19H16N2ClPS |
| Smiles | S=P(c1ccccc1)(c1ccccc1)N/N=C\c(cccc1)c1Cl |
| InChI | InChI=1S/C19H16ClN2PS/c20-19-14-8-7-9-16(19)15-21-22-23(24,17-10-3-1-4-11-17)18-12-5-2-6-13-18/h1-15H,(H,22,24) |
| InChIK | UMVLJJOZEMKWHD-UHFFFAOYSA-N |
| TotalMolweight | 370.843 |
| Molweight | 370.843 |
| MonoisotopicMass | 370.046032 |
| CLogP | 5.9106 |
| CLogS | -6.104 |
| H Acceptors | 2 |
| H Donors | 1 |
| TotalSurfaceArea | 283.15 |
| Relative PSA | 0.19407 |
| PolarSurfaceArea | 66.29 |
| Druglikeness | -11.909 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | low |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - 1-chloro-2-[(Z)-(diphenylphosphinothioylhydrazinylidene)methyl]benzene | 2 - 1-chloro-2-[(Z)-(diphenylphosphinothioylhydrazinylidene)methyl]benzene