| MolName | 2-(2-chlorophenoxy)-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]acetamide |
| MolecularFormula | C22H19N2O3Cl |
| Smiles | O=C(COc(cccc1)c1Cl)N/N=C\c1cc(OCc2ccccc2)ccc1 |
| InChI | InChI=1S/C22H19ClN2O3/c23-20-11-4-5-12-21(20)28-16-22(26)25-24-14-18-9-6-10-19(13-18)27-15-17-7-2-1-3-8-17/h1-14H,15-16H2,(H,25,26) |
| InChIK | UNGJIUMJLRNUNW-UHFFFAOYSA-N |
| TotalMolweight | 394.857 |
| Molweight | 394.857 |
| MonoisotopicMass | 394.10842 |
| CLogP | 4.7306 |
| CLogS | -5.578 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 309.69 |
| Relative PSA | 0.18086 |
| PolarSurfaceArea | 59.92 |
| Druglikeness | 4.2278 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-chlorophenoxy)-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]acetamide | 2 - 2-(2-chlorophenoxy)-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]acetamide