| MolName | 4-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-3-pyridin-2-yl-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C18H12N5OClS |
| Smiles | S=C(NN=C1c2ncccc2)N1/N=C\c1ccc(-c(cccc2)c2Cl)o1 |
| InChI | InChI=1S/C18H12ClN5OS/c19-14-6-2-1-5-13(14)16-9-8-12(25-16)11-21-24-17(22-23-18(24)26)15-7-3-4-10-20-15/h1-11H,(H,23,26) |
| InChIK | UNHSCZFCAOGXRD-UHFFFAOYSA-N |
| TotalMolweight | 381.846 |
| Molweight | 381.846 |
| MonoisotopicMass | 381.045107 |
| CLogP | 3.893 |
| CLogS | -5.876 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 285.35 |
| Relative PSA | 0.31929 |
| PolarSurfaceArea | 98.11 |
| Druglikeness | 6.1221 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.57692 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-3-pyridin-2-yl-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-3-pyridin-2-yl-1H-1,2,4-triazole-5-thione