| MolName | 4-chloro-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]benzenesulfonamide |
| MolecularFormula | C13H9N2O2Cl3S |
| Smiles | O=S(c(cc1)ccc1Cl)(N/N=C\c(ccc(Cl)c1)c1Cl)=O |
| InChI | InChI=1S/C13H9Cl3N2O2S/c14-10-3-5-12(6-4-10)21(19,20)18-17-8-9-1-2-11(15)7-13(9)16/h1-8,18H |
| InChIK | UNLXUOPCVDFKRN-UHFFFAOYSA-N |
| TotalMolweight | 363.651 |
| Molweight | 363.651 |
| MonoisotopicMass | 361.945029 |
| CLogP | 4.0951 |
| CLogS | -4.124 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 244.08 |
| Relative PSA | 0.2112 |
| PolarSurfaceArea | 66.91 |
| Druglikeness | 4.4251 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]benzenesulfonamide | 2 - 4-chloro-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]benzenesulfonamide