| MolName | [4-bromo-2-[(Z)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
| MolecularFormula | C21H13N3O5BrCl |
| Smiles | [O-][N+](c(cc1)ccc1C(N/N=C\c(cc(cc1)Br)c1OC(c(cccc1)c1Cl)=O)=O)=O |
| InChI | InChI=1S/C21H13BrClN3O5/c22-15-7-10-19(31-21(28)17-3-1-2-4-18(17)23)14(11-15)12-24-25-20(27)13-5-8-16(9-6-13)26(29)30/h1-12H,(H,25,27) |
| InChIK | UOGHGHSUWRAIKI-UHFFFAOYSA-N |
| TotalMolweight | 502.707 |
| Molweight | 502.707 |
| MonoisotopicMass | 500.97271 |
| CLogP | 5.0417 |
| CLogS | -7.221 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 332.22 |
| Relative PSA | 0.26931 |
| PolarSurfaceArea | 113.58 |
| Druglikeness | -2.8249 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58065 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate | 2 - [4-bromo-2-[(Z)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate