| MolName | 5-bromo-N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-2-hydroxybenzamide |
| MolecularFormula | C14H9N2O2BrClF |
| Smiles | Oc(ccc(Br)c1)c1C(N/N=C\c(c(F)ccc1)c1Cl)=O |
| InChI | InChI=1S/C14H9BrClFN2O2/c15-8-4-5-13(20)9(6-8)14(21)19-18-7-10-11(16)2-1-3-12(10)17/h1-7,20H,(H,19,21) |
| InChIK | UORYURDKTAIZPX-UHFFFAOYSA-N |
| TotalMolweight | 371.592 |
| Molweight | 371.592 |
| MonoisotopicMass | 369.951994 |
| CLogP | 4.2879 |
| CLogS | -5.309 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 233.74 |
| Relative PSA | 0.21011 |
| PolarSurfaceArea | 61.69 |
| Druglikeness | 1.2998 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-bromo-N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-2-hydroxybenzamide | 2 - 5-bromo-N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-2-hydroxybenzamide