| MolName | N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide |
| MolecularFormula | C16H14N2O2Cl2 |
| Smiles | Oc1ccc(CCC(N/N=C\c(cc2)cc(Cl)c2Cl)=O)cc1 |
| InChI | InChI=1S/C16H14Cl2N2O2/c17-14-7-3-12(9-15(14)18)10-19-20-16(22)8-4-11-1-5-13(21)6-2-11/h1-3,5-7,9-10,21H,4,8H2,(H,20,22) |
| InChIK | UOVQSUXHNKKKLA-UHFFFAOYSA-N |
| TotalMolweight | 337.205 |
| Molweight | 337.205 |
| MonoisotopicMass | 336.043232 |
| CLogP | 4.5204 |
| CLogS | -5.132 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 251.7 |
| Relative PSA | 0.19511 |
| PolarSurfaceArea | 61.69 |
| Druglikeness | 3.2105 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72727 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide | 2 - N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-3-(4-hydroxyphenyl)propanamide