| MolName | 4-hydroxy-N-[(Z)-2-[2-(4-hydroxybenzoyl)hydrazinyl]prop-2-enylideneamino]benzamide |
| MolecularFormula | C17H16N4O4 |
| Smiles | C=C(/C=N\NC(c(cc1)ccc1O)=O)NNC(c(cc1)ccc1O)=O |
| InChI | InChI=1S/C17H16N4O4/c1-11(19-21-17(25)13-4-8-15(23)9-5-13)10-18-20-16(24)12-2-6-14(22)7-3-12/h2-10,19,22-23H,1H2,(H,20,24)(H,21,25) |
| InChIK | UOYKIMFIAIXRPF-UHFFFAOYSA-N |
| TotalMolweight | 340.338 |
| Molweight | 340.338 |
| MonoisotopicMass | 340.117156 |
| CLogP | 1.3306 |
| CLogS | -3.702 |
| H Acceptors | 8 |
| H Donors | 5 |
| TotalSurfaceArea | 263.11 |
| Relative PSA | 0.37311 |
| PolarSurfaceArea | 123.05 |
| Druglikeness | 1.8404 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 4-hydroxy-N-[(Z)-2-[2-(4-hydroxybenzoyl)hydrazinyl]prop-2-enylideneamino]benzamide | 2 - 4-hydroxy-N-[(Z)-2-[2-(4-hydroxybenzoyl)hydrazinyl]prop-2-enylideneamino]benzamide