| MolName | N-[(Z)-(4,5-dibromofuran-2-yl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
| MolecularFormula | C19H14N2O3Br2 |
| Smiles | OC(C(N/N=C\c(o1)cc(Br)c1Br)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H14Br2N2O3/c20-16-11-15(26-17(16)21)12-22-23-18(24)19(25,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12,25H,(H,23,24) |
| InChIK | UPBXBAGUKZQMAP-UHFFFAOYSA-N |
| TotalMolweight | 478.139 |
| Molweight | 478.139 |
| MonoisotopicMass | 475.937115 |
| CLogP | 4.2184 |
| CLogS | -5.54 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 290.46 |
| Relative PSA | 0.21765 |
| PolarSurfaceArea | 74.83 |
| Druglikeness | 0.19761 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | 1,2-dihalo-alkene; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4,5-dibromofuran-2-yl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide | 2 - N-[(Z)-(4,5-dibromofuran-2-yl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide