| MolName | N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]furan-2-carboxamide |
| MolecularFormula | C18H19N3O5 |
| Smiles | O=C(COc1ccc(/C=N\NC(c2ccco2)=O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C18H19N3O5/c22-17(21-7-10-24-11-8-21)13-26-15-5-3-14(4-6-15)12-19-20-18(23)16-2-1-9-25-16/h1-6,9,12H,7-8,10-11,13H2,(H,20,23) |
| InChIK | UQERGYQPKILGOI-UHFFFAOYSA-N |
| TotalMolweight | 357.365 |
| Molweight | 357.365 |
| MonoisotopicMass | 357.132472 |
| CLogP | 1.6395 |
| CLogS | -2.893 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 280.03 |
| Relative PSA | 0.30965 |
| PolarSurfaceArea | 93.37 |
| Druglikeness | 6.1345 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]furan-2-carboxamide | 2 - N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]furan-2-carboxamide