| MolName | 4-[(4-chlorophenyl)methoxy]-N-[(Z)-[2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]benzamide |
| MolecularFormula | C28H22N2O3Cl2 |
| Smiles | O=C(c(cc1)ccc1OCc(cc1)ccc1Cl)N/N=C\c(cccc1)c1OCc(cc1)ccc1Cl |
| InChI | InChI=1S/C28H22Cl2N2O3/c29-24-11-5-20(6-12-24)18-34-26-15-9-22(10-16-26)28(33)32-31-17-23-3-1-2-4-27(23)35-19-21-7-13-25(30)14-8-21/h1-17H,18-19H2,(H,32,33) |
| InChIK | UQWRPPGHTUPPAM-UHFFFAOYSA-N |
| TotalMolweight | 505.4 |
| Molweight | 505.4 |
| MonoisotopicMass | 504.100747 |
| CLogP | 7.1098 |
| CLogS | -7.875 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 384.87 |
| Relative PSA | 0.14553 |
| PolarSurfaceArea | 59.92 |
| Druglikeness | 4.0514 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68571 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 4 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(4-chlorophenyl)methoxy]-N-[(Z)-[2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]benzamide | 2 - 4-[(4-chlorophenyl)methoxy]-N-[(Z)-[2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]benzamide