| MolName | 3-chloro-N-[4-[[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]phenyl]benzamide |
| MolecularFormula | C22H16N3O3Cl |
| Smiles | [O-][N+](c1cccc(/C=C/C=N/c(cc2)ccc2NC(c2cccc(Cl)c2)=O)c1)=O |
| InChI | InChI=1S/C22H16ClN3O3/c23-18-7-2-6-17(15-18)22(27)25-20-11-9-19(10-12-20)24-13-3-5-16-4-1-8-21(14-16)26(28)29/h1-15H,(H,25,27) |
| InChIK | UQYPKBYVCXWCGM-UHFFFAOYSA-N |
| TotalMolweight | 405.84 |
| Molweight | 405.84 |
| MonoisotopicMass | 405.088019 |
| CLogP | 3.8836 |
| CLogS | -6.158 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 312.34 |
| Relative PSA | 0.21268 |
| PolarSurfaceArea | 87.28 |
| Druglikeness | -3.5918 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.65517 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-chloro-N-[4-[[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]phenyl]benzamide | 2 - 3-chloro-N-[4-[[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]phenyl]benzamide