| MolName | 4-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-3-cyclohexyl-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C17H19N4ClS |
| Smiles | S=C(NN=C1C2CCCCC2)N1/N=C\C(\Cl)=C\c1ccccc1 |
| InChI | InChI=1S/C17H19ClN4S/c18-15(11-13-7-3-1-4-8-13)12-19-22-16(20-21-17(22)23)14-9-5-2-6-10-14/h1,3-4,7-8,11-12,14H,2,5-6,9-10H2,(H,21,23) |
| InChIK | URVLMQHGANREAC-UHFFFAOYSA-N |
| TotalMolweight | 346.885 |
| Molweight | 346.885 |
| MonoisotopicMass | 346.101893 |
| CLogP | 3.7005 |
| CLogS | -5.59 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 269.89 |
| Relative PSA | 0.24466 |
| PolarSurfaceArea | 72.08 |
| Druglikeness | -0.89818 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.6087 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-3-cyclohexyl-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-3-cyclohexyl-1H-1,2,4-triazole-5-thione