| MolName | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]benzamide |
| MolecularFormula | C23H17N3O2F2S2 |
| Smiles | O=C(c1ccc(CSc2nc(cccc3)c3s2)cc1)N/N=C\c(cc1)ccc1OC(F)F |
| InChI | InChI=1S/C23H17F2N3O2S2/c24-22(25)30-18-11-7-15(8-12-18)13-26-28-21(29)17-9-5-16(6-10-17)14-31-23-27-19-3-1-2-4-20(19)32-23/h1-13,22H,14H2,(H,28,29) |
| InChIK | URWHJJISDMPMKL-UHFFFAOYSA-N |
| TotalMolweight | 469.535 |
| Molweight | 469.535 |
| MonoisotopicMass | 469.073023 |
| CLogP | 5.8343 |
| CLogS | -7.608 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 342.5 |
| Relative PSA | 0.27688 |
| PolarSurfaceArea | 117.12 |
| Druglikeness | 1.8077 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 4 |
| Symmetricatoms | 5 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]benzamide | 2 - 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]benzamide