| MolName | 2-indol-1-yl-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide |
| MolecularFormula | C15H13N3OS |
| Smiles | O=C(Cn(cc1)c2c1cccc2)N/N=C\c1cccs1 |
| InChI | InChI=1S/C15H13N3OS/c19-15(17-16-10-13-5-3-9-20-13)11-18-8-7-12-4-1-2-6-14(12)18/h1-10H,11H2,(H,17,19) |
| InChIK | URZWCWVXDJFWRE-UHFFFAOYSA-N |
| TotalMolweight | 283.354 |
| Molweight | 283.354 |
| MonoisotopicMass | 283.077932 |
| CLogP | 2.735 |
| CLogS | -3.386 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 220.49 |
| Relative PSA | 0.28682 |
| PolarSurfaceArea | 74.63 |
| Druglikeness | 7.4092 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 14 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-indol-1-yl-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide | 2 - 2-indol-1-yl-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide