| MolName | 2-(12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide |
| MolecularFormula | C29H33N4OF |
| Smiles | O=C(CN1C(CCC2)c3c2c(cc(C2CCCCC2)cc2)c2n3CC1)N/N=C\c(cccc1)c1F |
| InChI | InChI=1S/C29H33FN4O/c30-25-11-5-4-9-22(25)18-31-32-28(35)19-33-15-16-34-26-14-13-21(20-7-2-1-3-8-20)17-24(26)23-10-6-12-27(33)29(23)34/h4-5,9,11,13-14,17-18,20,27H,1-3,6-8,10,12,15-16,19H2,(H,32,35)/t27-/m0/s1 |
| InChIK | USKCAKINUZECDZ-MHZLTWQESA-N |
| TotalMolweight | 472.606 |
| Molweight | 472.606 |
| MonoisotopicMass | 472.263839 |
| CLogP | 6.6935 |
| CLogS | -5.801 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 363.3 |
| Relative PSA | 0.1278 |
| PolarSurfaceArea | 49.63 |
| Druglikeness | 0.7114 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| StereoCenters | 1 |
| Rotatable Bond | 5 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 14 |
| Symmetricatoms | 2 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon | racemate |
Click to Load Molecule:
1 - 2-(12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide | 2 - 2-(12-cyclohexyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide