| MolName | N,N'-bis[(Z)-benzylideneamino]decanediamide |
| MolecularFormula | C24H30N4O2 |
| Smiles | O=C(CCCCCCCCC(N/N=C\c1ccccc1)=O)N/N=C\c1ccccc1 |
| InChI | InChI=1S/C24H30N4O2/c29-23(27-25-19-21-13-7-5-8-14-21)17-11-3-1-2-4-12-18-24(30)28-26-20-22-15-9-6-10-16-22/h5-10,13-16,19-20H,1-4,11-12,17-18H2,(H,27,29)(H,28,30) |
| InChIK | USQNUCNHNDJYHU-UHFFFAOYSA-N |
| TotalMolweight | 406.528 |
| Molweight | 406.528 |
| MonoisotopicMass | 406.236876 |
| CLogP | 6.1736 |
| CLogS | -6.278 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 351.04 |
| Relative PSA | 0.20516 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | -4.1295 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.8 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 13 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 17 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-benzylideneamino]decanediamide | 2 - N,N'-bis[(Z)-benzylideneamino]decanediamide