| MolName | [4-bromo-2-[(Z)-[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
| MolecularFormula | C26H18N2O4BrCl |
| Smiles | O=C(COc1cccc2ccccc12)N/N=C\c(cc(cc1)Br)c1OC(c(cccc1)c1Cl)=O |
| InChI | InChI=1S/C26H18BrClN2O4/c27-19-12-13-23(34-26(32)21-9-3-4-10-22(21)28)18(14-19)15-29-30-25(31)16-33-24-11-5-7-17-6-1-2-8-20(17)24/h1-15H,16H2,(H,30,31) |
| InChIK | USSHWNMSVIEKEI-UHFFFAOYSA-N |
| TotalMolweight | 537.796 |
| Molweight | 537.796 |
| MonoisotopicMass | 536.013846 |
| CLogP | 6.7326 |
| CLogS | -8.147 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 366.91 |
| Relative PSA | 0.18819 |
| PolarSurfaceArea | 76.99 |
| Druglikeness | 2.2306 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate | 2 - [4-bromo-2-[(Z)-[(2-naphthalen-1-yloxyacetyl)hydrazinylidene]methyl]phenyl] 2-chlorobenzoate