| MolName | 3-[[4-chloro-5-[(Z)-[(3-hydroxybenzoyl)hydrazinylidene]methyl]-2-oxo-1,3-thiazol-3-yl]methyl]benzoate |
| MolecularFormula | C19H13N3O5ClS |
| Smiles | [O-]C(c1cccc(CN(C(Cl)=C(/C=N\NC(c2cc(O)ccc2)=O)S2)C2=O)c1)=O |
| InChI | InChI=1S/C19H14ClN3O5S/c20-16-15(9-21-22-17(25)12-4-2-6-14(24)8-12)29-19(28)23(16)10-11-3-1-5-13(7-11)18(26)27/h1-9,24H,10H2,(H,22,25)(H,26,27)/p-1 |
| InChIK | UTDIUCBMMDBSPR-UHFFFAOYSA-M |
| TotalMolweight | 430.847 |
| Molweight | 430.847 |
| MonoisotopicMass | 430.026444 |
| CLogP | 0.6353 |
| CLogS | -5.045 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 302.76 |
| Relative PSA | 0.36501 |
| PolarSurfaceArea | 147.43 |
| Druglikeness | 7.4464 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | polar activated DB; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58621 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[[4-chloro-5-[(Z)-[(3-hydroxybenzoyl)hydrazinylidene]methyl]-2-oxo-1,3-thiazol-3-yl]methyl]benzoate | 2 - 3-[[4-chloro-5-[(Z)-[(3-hydroxybenzoyl)hydrazinylidene]methyl]-2-oxo-1,3-thiazol-3-yl]methyl]benzoate