| MolName | N-[(E)-(4-fluorophenyl)methylideneamino]-2-morpholin-4-yl-2-phenylacetamide |
| MolecularFormula | C19H20N3O2F |
| Smiles | O=C(C(c1ccccc1)N1CCOCC1)N/N=C/c(cc1)ccc1F |
| InChI | InChI=1S/C19H20FN3O2/c20-17-8-6-15(7-9-17)14-21-22-19(24)18(16-4-2-1-3-5-16)23-10-12-25-13-11-23/h1-9,14,18H,10-13H2,(H,22,24)/t18-/m1/s1 |
| InChIK | UTORJRLFJGUAGX-GOSISDBHSA-N |
| TotalMolweight | 341.385 |
| Molweight | 341.385 |
| MonoisotopicMass | 341.153955 |
| CLogP | 2.4196 |
| CLogS | -3.149 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 267.68 |
| Relative PSA | 0.18515 |
| PolarSurfaceArea | 53.93 |
| Druglikeness | 5.0118 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| StereoCenters | 1 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 6 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon | racemate |
Click to Load Molecule:
1 - N-[(E)-(4-fluorophenyl)methylideneamino]-2-morpholin-4-yl-2-phenylacetamide | 2 - N-[(E)-(4-fluorophenyl)methylideneamino]-2-morpholin-4-yl-2-phenylacetamide