| MolName | N-[(Z)-[1-[(3-fluorophenyl)methyl]indol-3-yl]methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide |
| MolecularFormula | C28H21N5OF4S |
| Smiles | O=C(Cc1csc(Nc2cc(C(F)(F)F)ccc2)n1)N/N=C\c1cn(Cc2cc(F)ccc2)c2c1cccc2 |
| InChI | InChI=1S/C28H21F4N5OS/c29-21-7-3-5-18(11-21)15-37-16-19(24-9-1-2-10-25(24)37)14-33-36-26(38)13-23-17-39-27(35-23)34-22-8-4-6-20(12-22)28(30,31)32/h1-12,14,16-17H,13,15H2,(H,34,35)(H,36,38) |
| InChIK | UTUZDRKLKADIBC-UHFFFAOYSA-N |
| TotalMolweight | 551.567 |
| Molweight | 551.567 |
| MonoisotopicMass | 551.140292 |
| CLogP | 6.8882 |
| CLogS | -7.091 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 399.8 |
| Relative PSA | 0.21428 |
| PolarSurfaceArea | 99.55 |
| Druglikeness | 0.050035 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | limit! thiazol-2-ylamine; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5641 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-[(3-fluorophenyl)methyl]indol-3-yl]methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide | 2 - N-[(Z)-[1-[(3-fluorophenyl)methyl]indol-3-yl]methylideneamino]-2-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetamide