| MolName | N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-1,3-thiazol-2-amine |
| MolecularFormula | C10H7N3ClFS |
| Smiles | Fc1cccc(Cl)c1/C=N\Nc1nccs1 |
| InChI | InChI=1S/C10H7ClFN3S/c11-8-2-1-3-9(12)7(8)6-14-15-10-13-4-5-16-10/h1-6H,(H,13,15) |
| InChIK | UTXQDLLPWIDAPY-UHFFFAOYSA-N |
| TotalMolweight | 255.704 |
| Molweight | 255.704 |
| MonoisotopicMass | 255.003322 |
| CLogP | 5.173 |
| CLogS | -3.932 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 185.71 |
| Relative PSA | 0.29239 |
| PolarSurfaceArea | 65.52 |
| Druglikeness | 1.6667 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-1,3-thiazol-2-amine | 2 - N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-1,3-thiazol-2-amine