| MolName | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]acetamide |
| MolecularFormula | C15H11N5O2Cl2S |
| Smiles | Nc1nnc(CC(N/N=C\c2ccc(-c(ccc(Cl)c3)c3Cl)o2)=O)s1 |
| InChI | InChI=1S/C15H11Cl2N5O2S/c16-8-1-3-10(11(17)5-8)12-4-2-9(24-12)7-19-20-13(23)6-14-21-22-15(18)25-14/h1-5,7H,6H2,(H2,18,22)(H,20,23) |
| InChIK | UTXZOORVJLNPAW-UHFFFAOYSA-N |
| TotalMolweight | 396.257 |
| Molweight | 396.257 |
| MonoisotopicMass | 395.001049 |
| CLogP | 3.5163 |
| CLogS | -5.901 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 283.02 |
| Relative PSA | 0.3805 |
| PolarSurfaceArea | 134.64 |
| Druglikeness | 7.7682 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]acetamide | 2 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]acetamide