| MolName | 2-[2-[(Z)-(1,4,5,6-tetrahydrocyclopenta[c]pyrazole-3-carbonylhydrazinylidene)methyl]phenoxy]acetate |
| MolecularFormula | C16H15N4O4 |
| Smiles | [O-]C(COc1c(/C=N\NC(c2n[nH]c3c2CCC3)=O)cccc1)=O |
| InChI | InChI=1S/C16H16N4O4/c21-14(22)9-24-13-7-2-1-4-10(13)8-17-20-16(23)15-11-5-3-6-12(11)18-19-15/h1-2,4,7-8H,3,5-6,9H2,(H,18,19)(H,20,23)(H,21,22)/p-1 |
| InChIK | UUGKXKRQRZBPSY-UHFFFAOYSA-M |
| TotalMolweight | 327.319 |
| Molweight | 327.319 |
| MonoisotopicMass | 327.109331 |
| CLogP | -0.998 |
| CLogS | -2.957 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 252.14 |
| Relative PSA | 0.38982 |
| PolarSurfaceArea | 119.5 |
| Druglikeness | 3.4042 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 6 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-(1,4,5,6-tetrahydrocyclopenta[c]pyrazole-3-carbonylhydrazinylidene)methyl]phenoxy]acetate | 2 - 2-[2-[(Z)-(1,4,5,6-tetrahydrocyclopenta[c]pyrazole-3-carbonylhydrazinylidene)methyl]phenoxy]acetate