| MolName | 2-chloro-N-[(E)-3-[(2Z)-2-[[5-(4-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| MolecularFormula | C27H18N4O5Cl2 |
| Smiles | [O-][N+](c1ccc(/C=C(\C(N/N=C\c2ccc(-c(cc3)ccc3Cl)o2)=O)/NC(c(cccc2)c2Cl)=O)cc1)=O |
| InChI | InChI=1S/C27H18Cl2N4O5/c28-19-9-7-18(8-10-19)25-14-13-21(38-25)16-30-32-27(35)24(15-17-5-11-20(12-6-17)33(36)37)31-26(34)22-3-1-2-4-23(22)29/h1-16H,(H,31,34)(H,32,35) |
| InChIK | UUIUAXXYVQCLQD-UHFFFAOYSA-N |
| TotalMolweight | 549.369 |
| Molweight | 549.369 |
| MonoisotopicMass | 548.065425 |
| CLogP | 6.0476 |
| CLogS | -8.858 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 404.63 |
| Relative PSA | 0.2596 |
| PolarSurfaceArea | 129.52 |
| Druglikeness | 3.0225 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52632 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-chloro-N-[(E)-3-[(2Z)-2-[[5-(4-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide | 2 - 2-chloro-N-[(E)-3-[(2Z)-2-[[5-(4-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide