| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide |
| MolecularFormula | C18H11N10O6Cl |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc2)cc([N+]([O-])=O)c2Cl)=O)c1-c(cc1)ccc1[N+]([O-])=O |
| InChI | InChI=1S/C18H11ClN10O6/c19-12-6-1-9(7-13(12)29(33)34)8-21-23-18(30)14-15(10-2-4-11(5-3-10)28(31)32)27(26-22-14)17-16(20)24-35-25-17/h1-8H,(H2,20,24)(H,23,30) |
| InChIK | UUQMALAKOHTLND-UHFFFAOYSA-N |
| TotalMolweight | 498.802 |
| Molweight | 498.802 |
| MonoisotopicMass | 498.055157 |
| CLogP | 2.2084 |
| CLogS | -4.862 |
| H Acceptors | 16 |
| H Donors | 2 |
| TotalSurfaceArea | 351.72 |
| Relative PSA | 0.50318 |
| PolarSurfaceArea | 228.75 |
| Druglikeness | -3.0594 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48571 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 17 |
| Electronegative Atoms | 17 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 5 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide